C6H9NO — CID 144672235
3,4-dimethyl-6H-oxazine (PubChem CID 144672235) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is 3,4-dimethyl-6H-oxazine.
| Compound Name | 3,4-dimethyl-6H-oxazine |
|---|---|
| PubChem CID | 144672235 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 3,4-dimethyl-6H-oxazine |
| SMILES | CC1=CCON=C1C |
| InChI | InChI=1S/C6H9NO/c1-5-3-4-8-7-6(5)2/h3H,4H2,1-2H3 |
| InChIKey | HYIMCSAGAHIELM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |