C15H24N6O6 — CID 535829
3,4,10,11,17,18-hexamethyl-1,6,8,13,15,20-hexaoxa-2,5,9,12,16,19-hexazacyclohenicosa-2,4,9,11,16,18-hexaene (PubChem CID 535829) has the molecular formula C15H24N6O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3,4,10,11,17,18-hexamethyl-1,6,8,13,15,20-hexaoxa-2,5,9,12,16,19-hexazacyclohenicosa-2,4,9,11,16,18-hexaene.
| Compound Name | 3,4,10,11,17,18-hexamethyl-1,6,8,13,15,20-hexaoxa-2,5,9,12,16,19-hexazacyclohenicosa-2,4,9,11,16,18-hexaene |
|---|---|
| PubChem CID | 535829 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3,4,10,11,17,18-hexamethyl-1,6,8,13,15,20-hexaoxa-2,5,9,12,16,19-hexazacyclohenicosa-2,4,9,11,16,18-hexaene |
| SMILES | CC1=NOCON=C(C)C(C)=NOCON=C(C)C(C)=NOCON=C1C |
| InChI | InChI=1S/C15H24N6O6/c1-10-11(2)17-23-8-25-19-14(5)15(6)21-27-9-26-20-13(4)12(3)18-24-7-22-16-10/h7-9H2,1-6H3 |
| InChIKey | JCYNUGYUQZOIMT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 129.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |