C16H20Ag2F6N4O8 — CID 139127199
disilver;(2E,6E,10E,14E)-3,7,11,15-tetramethyl-1,5,9,13-tetraoxa-2,6,10,14-tetrazacyclohexadeca-2,6,10,14-tetraene;bis(2,2,2-trifluoroacetate) (PubChem CID 139127199) has the molecular formula C16H20Ag2F6N4O8 and a molecular weight of 726.08 g/mol. Its IUPAC name is disilver;(2E,6E,10E,14E)-3,7,11,15-tetramethyl-1,5,9,13-tetraoxa-2,6,10,14-tetrazacyclohexadeca-2,6,10,14-tetraene;bis(2,2,2-trifluoroacetate).
| Compound Name | disilver;(2E,6E,10E,14E)-3,7,11,15-tetramethyl-1,5,9,13-tetraoxa-2,6,10,14-tetrazacyclohexadeca-2,6,10,14-tetraene;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 139127199 |
| Molecular Formula | C16H20Ag2F6N4O8 |
| Molecular Weight | 726.08 g/mol |
| Exact Mass | 723.93 |
| IUPAC Name | disilver;(2E,6E,10E,14E)-3,7,11,15-tetramethyl-1,5,9,13-tetraoxa-2,6,10,14-tetrazacyclohexadeca-2,6,10,14-tetraene;bis(2,2,2-trifluoroacetate) |
| SMILES | C/C1=N/OC/C(C)=N/OC/C(C)=N/OC/C(C)=N/OC1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Ag+].[Ag+] |
| InChI | InChI=1S/C12H20N4O4.2C2HF3O2.2Ag/c1-9-5-17-14-11(3)7-19-16-12(4)8-20-15-10(2)6-18-13-9;2*3-2(4,5)1(6)7;;/h5-8H2,1-4H3;2*(H,6,7);;/q;;;2*+1/p-2/b13-9-,14-11+,15-10+,16-12+;;;; |
| InChIKey | ZBSHCMCHBAJWAC-JTXCZGCLSA-L |
| XLogP | 0.16 |
| TPSA | 166.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.08 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |