C5H8F3NO2 — CID 11298207
dimethyl(methylidene)azanium;2,2,2-trifluoroacetate (PubChem CID 11298207) has the molecular formula C5H8F3NO2 and a molecular weight of 171.12 g/mol. Its IUPAC name is dimethyl(methylidene)azanium;2,2,2-trifluoroacetate.
| Compound Name | dimethyl(methylidene)azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11298207 |
| Molecular Formula | C5H8F3NO2 |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | dimethyl(methylidene)azanium;2,2,2-trifluoroacetate |
| SMILES | C=[N+](C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C3H8N.C2HF3O2/c1-4(2)3;3-2(4,5)1(6)7/h1H2,2-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | YPMYDJDJOCCNSE-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|