C16H25NO3 — CID 144672490
ethane;(4-methoxyphenyl)methyl N-(1-ethylcyclopropyl)carbamate (PubChem CID 144672490) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is ethane;(4-methoxyphenyl)methyl N-(1-ethylcyclopropyl)carbamate.
| Compound Name | ethane;(4-methoxyphenyl)methyl N-(1-ethylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 144672490 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | ethane;(4-methoxyphenyl)methyl N-(1-ethylcyclopropyl)carbamate |
| SMILES | CC.CCC1(NC(=O)OCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C14H19NO3.C2H6/c1-3-14(8-9-14)15-13(16)18-10-11-4-6-12(17-2)7-5-11;1-2/h4-7H,3,8-10H2,1-2H3,(H,15,16);1-2H3 |
| InChIKey | PGJYZRNBQKMMNF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |