C22H30ClNO3 — CID 170722071
(4-methoxyphenyl)methyl N-[2-(chloromethyl)-3,5-dimethyl-1-adamantyl]carbamate (PubChem CID 170722071) has the molecular formula C22H30ClNO3 and a molecular weight of 391.94 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[2-(chloromethyl)-3,5-dimethyl-1-adamantyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[2-(chloromethyl)-3,5-dimethyl-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 170722071 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[2-(chloromethyl)-3,5-dimethyl-1-adamantyl]carbamate |
| SMILES | COc1ccc(COC(=O)NC23CC4CC(C)(CC(C)(C4)C2CCl)C3)cc1 |
| InChI | InChI=1S/C22H30ClNO3/c1-20-8-16-9-21(2,13-20)18(11-23)22(10-16,14-20)24-19(25)27-12-15-4-6-17(26-3)7-5-15/h4-7,16,18H,8-14H2,1-3H3,(H,24,25) |
| InChIKey | GVYQAVCXEYLDCF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|