C26H29N5O4 — CID 144673070
[5-[bis[(4-methoxyphenyl)methyl]amino]-1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]-oxidoazanium (PubChem CID 144673070) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is [5-[bis[(4-methoxyphenyl)methyl]amino]-1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]-oxidoazanium.
| Compound Name | [5-[bis[(4-methoxyphenyl)methyl]amino]-1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]-oxidoazanium |
|---|---|
| PubChem CID | 144673070 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | [5-[bis[(4-methoxyphenyl)methyl]amino]-1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]-oxidoazanium |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc([NH2+][O-])nn2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H29N5O4/c1-33-22-10-4-19(5-11-22)16-30(17-20-6-12-23(34-2)13-7-20)26-27-25(29-32)28-31(26)18-21-8-14-24(35-3)15-9-21/h4-15H,16-18,29H2,1-3H3 |
| InChIKey | CSOXAYPTLMPNAU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|