C34H34F3N5O2 — CID 129131802
5-N,1-bis[(4-methoxyphenyl)methyl]-5-N-[(4-methylphenyl)methyl]-3-N-[3-(2,2,2-trifluoroethyl)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 129131802) has the molecular formula C34H34F3N5O2 and a molecular weight of 601.67 g/mol. Its IUPAC name is 5-N,1-bis[(4-methoxyphenyl)methyl]-5-N-[(4-methylphenyl)methyl]-3-N-[3-(2,2,2-trifluoroethyl)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N,1-bis[(4-methoxyphenyl)methyl]-5-N-[(4-methylphenyl)methyl]-3-N-[3-(2,2,2-trifluoroethyl)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 129131802 |
| Molecular Formula | C34H34F3N5O2 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 5-N,1-bis[(4-methoxyphenyl)methyl]-5-N-[(4-methylphenyl)methyl]-3-N-[3-(2,2,2-trifluoroethyl)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | COc1ccc(CN(Cc2ccc(C)cc2)c2nc(Nc3cccc(CC(F)(F)F)c3)nn2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H34F3N5O2/c1-24-7-9-25(10-8-24)21-41(22-26-11-15-30(43-2)16-12-26)33-39-32(38-29-6-4-5-28(19-29)20-34(35,36)37)40-42(33)23-27-13-17-31(44-3)18-14-27/h4-19H,20-23H2,1-3H3,(H,38,40) |
| InChIKey | ODKIXEGUAZXPOU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |