C20H14F2N2O4S — CID 144675349
methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 144675349) has the molecular formula C20H14F2N2O4S and a molecular weight of 416.41 g/mol. Its IUPAC name is methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 144675349 |
| Molecular Formula | C20H14F2N2O4S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | COC(=O)/C(C#N)=C1\SCC(=O)N1c1c(F)cc(-c2cccc(OC)c2)cc1F |
| InChI | InChI=1S/C20H14F2N2O4S/c1-27-13-5-3-4-11(6-13)12-7-15(21)18(16(22)8-12)24-17(25)10-29-19(24)14(9-23)20(26)28-2/h3-8H,10H2,1-2H3/b19-14- |
| InChIKey | QKZBGZKNFZZQIB-RGEXLXHISA-N |
| XLogP | 3.63 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|