C26H25F2N3O6S — CID 144675370
ethane;methyl 2-cyanoacetate;methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 144675370) has the molecular formula C26H25F2N3O6S and a molecular weight of 545.56 g/mol. Its IUPAC name is ethane;methyl 2-cyanoacetate;methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethane;methyl 2-cyanoacetate;methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 144675370 |
| Molecular Formula | C26H25F2N3O6S |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | ethane;methyl 2-cyanoacetate;methyl (2Z)-2-cyano-2-[3-[2,6-difluoro-4-(3-methoxyphenyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CC.COC(=O)/C(C#N)=C1\SCC(=O)N1c1c(F)cc(-c2cccc(OC)c2)cc1F.COC(=O)CC#N |
| InChI | InChI=1S/C20H14F2N2O4S.C4H5NO2.C2H6/c1-27-13-5-3-4-11(6-13)12-7-15(21)18(16(22)8-12)24-17(25)10-29-19(24)14(9-23)20(26)28-2;1-7-4(6)2-3-5;1-2/h3-8H,10H2,1-2H3;2H2,1H3;1-2H3/b19-14-;; |
| InChIKey | DPZBDBYYCRTNGB-MHZTUVSFSA-N |
| XLogP | 4.73 |
| TPSA | 129.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|