C18H29ClN4O4 — CID 144676064
5-chloro-2,4-dimethoxybenzene-1,3-diamine;2-(2,6-diaminophenoxy)ethanol;ethane (PubChem CID 144676064) has the molecular formula C18H29ClN4O4 and a molecular weight of 400.91 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxybenzene-1,3-diamine;2-(2,6-diaminophenoxy)ethanol;ethane.
| Compound Name | 5-chloro-2,4-dimethoxybenzene-1,3-diamine;2-(2,6-diaminophenoxy)ethanol;ethane |
|---|---|
| PubChem CID | 144676064 |
| Molecular Formula | C18H29ClN4O4 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-chloro-2,4-dimethoxybenzene-1,3-diamine;2-(2,6-diaminophenoxy)ethanol;ethane |
| SMILES | CC.COc1c(N)cc(Cl)c(OC)c1N.Nc1cccc(N)c1OCCO |
| InChI | InChI=1S/C8H11ClN2O2.C8H12N2O2.C2H6/c1-12-7-4(9)3-5(10)8(13-2)6(7)11;9-6-2-1-3-7(10)8(6)12-5-4-11;1-2/h3H,10-11H2,1-2H3;1-3,11H,4-5,9-10H2;1-2H3 |
| InChIKey | ZVBKSIQHOLXOPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|