C18H27O10P — CID 144676906
3-[hydroxy-[1-[3-(2-hydroxyphenyl)propanoyloxy]-2-methoxypentan-3-yl]oxyphosphoryl]oxypropanoic acid (PubChem CID 144676906) has the molecular formula C18H27O10P and a molecular weight of 434.38 g/mol. Its IUPAC name is 3-[hydroxy-[1-[3-(2-hydroxyphenyl)propanoyloxy]-2-methoxypentan-3-yl]oxyphosphoryl]oxypropanoic acid.
| Compound Name | 3-[hydroxy-[1-[3-(2-hydroxyphenyl)propanoyloxy]-2-methoxypentan-3-yl]oxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 144676906 |
| Molecular Formula | C18H27O10P |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 3-[hydroxy-[1-[3-(2-hydroxyphenyl)propanoyloxy]-2-methoxypentan-3-yl]oxyphosphoryl]oxypropanoic acid |
| SMILES | CCC(OP(=O)(O)OCCC(=O)O)C(COC(=O)CCc1ccccc1O)OC |
| InChI | InChI=1S/C18H27O10P/c1-3-15(28-29(23,24)27-11-10-17(20)21)16(25-2)12-26-18(22)9-8-13-6-4-5-7-14(13)19/h4-7,15-16,19H,3,8-12H2,1-2H3,(H,20,21)(H,23,24) |
| InChIKey | CPRNRTBSWVLWDQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|