C33H40N6O3S — CID 144677872
N-(1-cyclobutylcyclopropyl)-7-(6-ethynylspiro[2.5]octan-2-yl)-2-methylsulfonyl-8-[(3R)-3-phenylmorpholin-4-yl]purin-6-amine (PubChem CID 144677872) has the molecular formula C33H40N6O3S and a molecular weight of 600.79 g/mol. Its IUPAC name is N-(1-cyclobutylcyclopropyl)-7-(6-ethynylspiro[2.5]octan-2-yl)-2-methylsulfonyl-8-[(3R)-3-phenylmorpholin-4-yl]purin-6-amine.
| Compound Name | N-(1-cyclobutylcyclopropyl)-7-(6-ethynylspiro[2.5]octan-2-yl)-2-methylsulfonyl-8-[(3R)-3-phenylmorpholin-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 144677872 |
| Molecular Formula | C33H40N6O3S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | N-(1-cyclobutylcyclopropyl)-7-(6-ethynylspiro[2.5]octan-2-yl)-2-methylsulfonyl-8-[(3R)-3-phenylmorpholin-4-yl]purin-6-amine |
| SMILES | C#CC1CCC2(CC1)CC2n1c(N2CCOC[C@H]2c2ccccc2)nc2nc(S(C)(=O)=O)nc(NC3(C4CCC4)CC3)c21 |
| InChI | InChI=1S/C33H40N6O3S/c1-3-22-12-14-32(15-13-22)20-26(32)39-27-28(36-31(39)38-18-19-42-21-25(38)23-8-5-4-6-9-23)34-30(43(2,40)41)35-29(27)37-33(16-17-33)24-10-7-11-24/h1,4-6,8-9,22,24-26H,7,10-21H2,2H3,(H,34,35,37)/t22?,25-,26?,32?/m0/s1 |
| InChIKey | MWRTWKCYXQHNOZ-CIVQUFIYSA-N |
| XLogP | 5.31 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|