C31H34N4O4S — CID 144678855
N-formyl-3-[4-[[1-methyl-6-(2-piperidin-1-ylphenoxy)benzimidazol-2-yl]methoxy]phenyl]-2-methylsulfanylpropanamide (PubChem CID 144678855) has the molecular formula C31H34N4O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is N-formyl-3-[4-[[1-methyl-6-(2-piperidin-1-ylphenoxy)benzimidazol-2-yl]methoxy]phenyl]-2-methylsulfanylpropanamide.
| Compound Name | N-formyl-3-[4-[[1-methyl-6-(2-piperidin-1-ylphenoxy)benzimidazol-2-yl]methoxy]phenyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 144678855 |
| Molecular Formula | C31H34N4O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | N-formyl-3-[4-[[1-methyl-6-(2-piperidin-1-ylphenoxy)benzimidazol-2-yl]methoxy]phenyl]-2-methylsulfanylpropanamide |
| SMILES | CSC(Cc1ccc(OCc2nc3ccc(Oc4ccccc4N4CCCCC4)cc3n2C)cc1)C(=O)NC=O |
| InChI | InChI=1S/C31H34N4O4S/c1-34-27-19-24(39-28-9-5-4-8-26(28)35-16-6-3-7-17-35)14-15-25(27)33-30(34)20-38-23-12-10-22(11-13-23)18-29(40-2)31(37)32-21-36/h4-5,8-15,19,21,29H,3,6-7,16-18,20H2,1-2H3,(H,32,36,37) |
| InChIKey | DQFLMDHLTQROAJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|