C28H30N4O4S — CID 144678867
4-[3-methyl-2-[(4-methylphenoxy)methyl]benzimidazol-5-yl]oxy-N-propan-2-ylaniline;1,3-thiazolidine-2,4-dione (PubChem CID 144678867) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 4-[3-methyl-2-[(4-methylphenoxy)methyl]benzimidazol-5-yl]oxy-N-propan-2-ylaniline;1,3-thiazolidine-2,4-dione.
| Compound Name | 4-[3-methyl-2-[(4-methylphenoxy)methyl]benzimidazol-5-yl]oxy-N-propan-2-ylaniline;1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 144678867 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-[3-methyl-2-[(4-methylphenoxy)methyl]benzimidazol-5-yl]oxy-N-propan-2-ylaniline;1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(OCc2nc3ccc(Oc4ccc(NC(C)C)cc4)cc3n2C)cc1.O=C1CSC(=O)N1 |
| InChI | InChI=1S/C25H27N3O2.C3H3NO2S/c1-17(2)26-19-7-11-21(12-8-19)30-22-13-14-23-24(15-22)28(4)25(27-23)16-29-20-9-5-18(3)6-10-20;5-2-1-7-3(6)4-2/h5-15,17,26H,16H2,1-4H3;1H2,(H,4,5,6) |
| InChIKey | GUIYDAVNZDYCHB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|