About butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine
butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine (PubChem CID 144679682) has the molecular formula C17H21FN2O
and a molecular weight of 288.37 g/mol. Its IUPAC name is butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine.
Molecular Properties
| Compound Name | butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine |
| PubChem CID | 144679682 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine |
| SMILES | C=C/N=C(\C)c1cc2c(F)cccc2n1C.CCCC=O |
| InChI | InChI=1S/C13H13FN2.C4H8O/c1-4-15-9(2)13-8-10-11(14)6-5-7-12(10)16(13)3;1-2-3-4-5/h4-8H,1H2,2-3H3;4H,2-3H2,1H3/b15-9+; |
| InChIKey | UDRNWPCVRFHSIF-NSPIFIKESA-N |
| XLogP | 4.26 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine?
The IUPAC name of butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine (CID 144679682) is butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine.
What is the SMILES notation for butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine?
The canonical SMILES for butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine is C=C/N=C(\C)c1cc2c(F)cccc2n1C.CCCC=O.
What is the InChIKey of butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine?
The InChIKey is UDRNWPCVRFHSIF-NSPIFIKESA-N. The full InChI is InChI=1S/C13H13FN2.C4H8O/c1-4-15-9(2)13-8-10-11(14)6-5-7-12(10)16(13)3;1-2-3-4-5/h4-8H,1H2,2-3H3;4H,2-3H2,1H3/b15-9+;.
What are the key properties of butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine?
butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine has a molecular weight of 288.37 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanal;N-ethenyl-1-(4-fluoro-1-methylindol-2-yl)ethanimine is sourced from PubChem (CID 144679682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).