About ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde
ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde (PubChem CID 144679703) has the molecular formula C22H35FN2O
and a molecular weight of 362.53 g/mol. Its IUPAC name is ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde.
Molecular Properties
| Compound Name | ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde |
| PubChem CID | 144679703 |
| Molecular Formula | C22H35FN2O |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde |
| SMILES | C=C(C)/C(=N\CCC)c1cc2c(F)cccc2n1CC.C=O.CC.CC |
| InChI | InChI=1S/C17H21FN2.2C2H6.CH2O/c1-5-10-19-17(12(3)4)16-11-13-14(18)8-7-9-15(13)20(16)6-2;3*1-2/h7-9,11H,3,5-6,10H2,1-2,4H3;2*1-2H3;1H2/b19-17+;;; |
| InChIKey | DKYZNULHPQGXOC-BBNHCHDCSA-N |
| XLogP | 6.44 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde?
The IUPAC name of ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde (CID 144679703) is ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde.
What is the SMILES notation for ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde?
The canonical SMILES for ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde is C=C(C)/C(=N\CCC)c1cc2c(F)cccc2n1CC.C=O.CC.CC.
What is the InChIKey of ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde?
The InChIKey is DKYZNULHPQGXOC-BBNHCHDCSA-N. The full InChI is InChI=1S/C17H21FN2.2C2H6.CH2O/c1-5-10-19-17(12(3)4)16-11-13-14(18)8-7-9-15(13)20(16)6-2;3*1-2/h7-9,11H,3,5-6,10H2,1-2,4H3;2*1-2H3;1H2/b19-17+;;;.
What are the key properties of ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde?
ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde has a molecular weight of 362.53 g/mol, XLogP of 6.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(1-ethyl-4-fluoroindol-2-yl)-2-methyl-N-propylprop-2-en-1-imine;formaldehyde is sourced from PubChem (CID 144679703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).