C16H20BNO4S — CID 144679900
6-[methyl(sulfanyl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carbaldehyde (PubChem CID 144679900) has the molecular formula C16H20BNO4S and a molecular weight of 333.22 g/mol. Its IUPAC name is 6-[methyl(sulfanyl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carbaldehyde.
| Compound Name | 6-[methyl(sulfanyl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 144679900 |
| Molecular Formula | C16H20BNO4S |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 6-[methyl(sulfanyl)amino]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carbaldehyde |
| SMILES | CN(S)c1cc2occ(C=O)c2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H20BNO4S/c1-15(2)16(3,4)22-17(21-15)12-6-11-10(8-19)9-20-14(11)7-13(12)18(5)23/h6-9,23H,1-5H3 |
| InChIKey | UELVKBSQLQQWAM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|