C28H49N — CID 144681855
1-(2-ethyl-2,4b,7,7,10a-pentamethyl-1,3,4,4a,5,6,6a,10,10b,11,12,12a-dodecahydrochrysen-1-yl)propan-2-amine (PubChem CID 144681855) has the molecular formula C28H49N and a molecular weight of 399.71 g/mol. Its IUPAC name is 1-(2-ethyl-2,4b,7,7,10a-pentamethyl-1,3,4,4a,5,6,6a,10,10b,11,12,12a-dodecahydrochrysen-1-yl)propan-2-amine.
| Compound Name | 1-(2-ethyl-2,4b,7,7,10a-pentamethyl-1,3,4,4a,5,6,6a,10,10b,11,12,12a-dodecahydrochrysen-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 144681855 |
| Molecular Formula | C28H49N |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | 1-(2-ethyl-2,4b,7,7,10a-pentamethyl-1,3,4,4a,5,6,6a,10,10b,11,12,12a-dodecahydrochrysen-1-yl)propan-2-amine |
| SMILES | CCC1(C)CCC2C(CCC3C2(C)CCC2C(C)(C)C=CCC23C)C1CC(C)N |
| InChI | InChI=1S/C28H49N/c1-8-26(5)16-12-21-20(22(26)18-19(2)29)10-11-24-27(21,6)17-13-23-25(3,4)14-9-15-28(23,24)7/h9,14,19-24H,8,10-13,15-18,29H2,1-7H3 |
| InChIKey | ROYSAFAZFXARKA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|