C15H16N2O2S — CID 144683097
S-(cyclohexa-1,5-diene-1-carbonylamino) 4-(methylamino)benzenecarbothioate (PubChem CID 144683097) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is S-(cyclohexa-1,5-diene-1-carbonylamino) 4-(methylamino)benzenecarbothioate.
| Compound Name | S-(cyclohexa-1,5-diene-1-carbonylamino) 4-(methylamino)benzenecarbothioate |
|---|---|
| PubChem CID | 144683097 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | S-(cyclohexa-1,5-diene-1-carbonylamino) 4-(methylamino)benzenecarbothioate |
| SMILES | CNc1ccc(C(=O)SNC(=O)C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C15H16N2O2S/c1-16-13-9-7-12(8-10-13)15(19)20-17-14(18)11-5-3-2-4-6-11/h3,5-10,16H,2,4H2,1H3,(H,17,18) |
| InChIKey | WUTGVZRECAILCB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|