C10H14N2 — CID 144683308
N-methyl-6-(prop-2-enylideneamino)cyclohexa-1,5-dien-1-amine (PubChem CID 144683308) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-methyl-6-(prop-2-enylideneamino)cyclohexa-1,5-dien-1-amine.
| Compound Name | N-methyl-6-(prop-2-enylideneamino)cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 144683308 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-methyl-6-(prop-2-enylideneamino)cyclohexa-1,5-dien-1-amine |
| SMILES | C=C/C=N/C1=CCCC=C1NC |
| InChI | InChI=1S/C10H14N2/c1-3-8-12-10-7-5-4-6-9(10)11-2/h3,6-8,11H,1,4-5H2,2H3/b12-8+ |
| InChIKey | JBJXVNNMMVYWPL-XYOKQWHBSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|