C9H8N2 — CID 141369396
8H-pyrido[2,3-c]azepine (PubChem CID 141369396) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is 8H-pyrido[2,3-c]azepine.
| Compound Name | 8H-pyrido[2,3-c]azepine |
|---|---|
| PubChem CID | 141369396 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 8H-pyrido[2,3-c]azepine |
| SMILES | C1=CNC=c2ncccc2=C1 |
| InChI | InChI=1S/C9H8N2/c1-3-8-4-2-6-11-9(8)7-10-5-1/h1-7,10H |
| InChIKey | IAVKXTBJWQRVDA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |