C28H37ClN4O4 — CID 144685683
(2E,4E)-4-chloro-6-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinazolin-4-yl]oxynona-2,4,7-trien-3-amine (PubChem CID 144685683) has the molecular formula C28H37ClN4O4 and a molecular weight of 529.08 g/mol. Its IUPAC name is (2E,4E)-4-chloro-6-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinazolin-4-yl]oxynona-2,4,7-trien-3-amine.
| Compound Name | (2E,4E)-4-chloro-6-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinazolin-4-yl]oxynona-2,4,7-trien-3-amine |
|---|---|
| PubChem CID | 144685683 |
| Molecular Formula | C28H37ClN4O4 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | (2E,4E)-4-chloro-6-[6-methoxy-7-[3-(2-oxa-7-azaspiro[3.5]nonan-7-yl)propoxy]quinazolin-4-yl]oxynona-2,4,7-trien-3-amine |
| SMILES | CC=CC(/C=C(Cl)\C(N)=C/C)Oc1ncnc2cc(OCCCN3CCC4(CC3)COC4)c(OC)cc12 |
| InChI | InChI=1S/C28H37ClN4O4/c1-4-7-20(14-22(29)23(30)5-2)37-27-21-15-25(34-3)26(16-24(21)31-19-32-27)36-13-6-10-33-11-8-28(9-12-33)17-35-18-28/h4-5,7,14-16,19-20H,6,8-13,17-18,30H2,1-3H3/b7-4?,22-14+,23-5+ |
| InChIKey | PRKAUPDHURQFJB-AESUXFATSA-N |
| XLogP | 4.83 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|