C27H21ClF6O — CID 144687254
3-chloro-1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-4-(4-ethylcyclohex-2-en-1-yl)-2-fluorobenzene (PubChem CID 144687254) has the molecular formula C27H21ClF6O and a molecular weight of 510.91 g/mol. Its IUPAC name is 3-chloro-1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-4-(4-ethylcyclohex-2-en-1-yl)-2-fluorobenzene.
| Compound Name | 3-chloro-1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-4-(4-ethylcyclohex-2-en-1-yl)-2-fluorobenzene |
|---|---|
| PubChem CID | 144687254 |
| Molecular Formula | C27H21ClF6O |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 3-chloro-1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-4-(4-ethylcyclohex-2-en-1-yl)-2-fluorobenzene |
| SMILES | CCC1C=CC(c2ccc(-c3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)cc3)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C27H21ClF6O/c1-2-15-3-5-16(6-4-15)20-11-12-21(25(31)24(20)28)17-7-9-18(10-8-17)27(33,34)35-19-13-22(29)26(32)23(30)14-19/h3,5,7-16H,2,4,6H2,1H3 |
| InChIKey | QCFFFYXATZJWLM-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|