C27H21F7O — CID 144684838
5-[4-[[4-(4-ethylcyclohex-2-en-1-yl)-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 144684838) has the molecular formula C27H21F7O and a molecular weight of 494.45 g/mol. Its IUPAC name is 5-[4-[[4-(4-ethylcyclohex-2-en-1-yl)-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[[4-(4-ethylcyclohex-2-en-1-yl)-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 144684838 |
| Molecular Formula | C27H21F7O |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 5-[4-[[4-(4-ethylcyclohex-2-en-1-yl)-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | CCC1C=CC(c2ccc(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H21F7O/c1-2-15-3-5-16(6-4-15)17-7-10-21(23(29)11-17)27(33,34)35-19-8-9-20(22(28)14-19)18-12-24(30)26(32)25(31)13-18/h3,5,7-16H,2,4,6H2,1H3 |
| InChIKey | PYZMIYLSHZEUIU-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|