C18H30O4 — CID 144690797
ethane;ethene;methyl (5Z)-2-acetyloxy-5-[(Z)-prop-1-enyl]octa-5,7-dienoate (PubChem CID 144690797) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is ethane;ethene;methyl (5Z)-2-acetyloxy-5-[(Z)-prop-1-enyl]octa-5,7-dienoate.
| Compound Name | ethane;ethene;methyl (5Z)-2-acetyloxy-5-[(Z)-prop-1-enyl]octa-5,7-dienoate |
|---|---|
| PubChem CID | 144690797 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethane;ethene;methyl (5Z)-2-acetyloxy-5-[(Z)-prop-1-enyl]octa-5,7-dienoate |
| SMILES | C=C.C=C/C=C(\C=C/C)CCC(OC(C)=O)C(=O)OC.CC |
| InChI | InChI=1S/C14H20O4.C2H6.C2H4/c1-5-7-12(8-6-2)9-10-13(14(16)17-4)18-11(3)15;2*1-2/h5-8,13H,1,9-10H2,2-4H3;1-2H3;1-2H2/b8-6-,12-7+;; |
| InChIKey | NDBBLANAMCQYFL-YNUTXKHCSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|