C13H14F6N2O — CID 144692960
1-[(2E)-4-(trifluoromethyl)-2-[(E)-3,3,3-trifluoroprop-1-enyl]penta-2,4-dienyl]piperazin-2-one (PubChem CID 144692960) has the molecular formula C13H14F6N2O and a molecular weight of 328.26 g/mol. Its IUPAC name is 1-[(2E)-4-(trifluoromethyl)-2-[(E)-3,3,3-trifluoroprop-1-enyl]penta-2,4-dienyl]piperazin-2-one.
| Compound Name | 1-[(2E)-4-(trifluoromethyl)-2-[(E)-3,3,3-trifluoroprop-1-enyl]penta-2,4-dienyl]piperazin-2-one |
|---|---|
| PubChem CID | 144692960 |
| Molecular Formula | C13H14F6N2O |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-[(2E)-4-(trifluoromethyl)-2-[(E)-3,3,3-trifluoroprop-1-enyl]penta-2,4-dienyl]piperazin-2-one |
| SMILES | C=C(/C=C(\C=C\C(F)(F)F)CN1CCNCC1=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F6N2O/c1-9(13(17,18)19)6-10(2-3-12(14,15)16)8-21-5-4-20-7-11(21)22/h2-3,6,20H,1,4-5,7-8H2/b3-2+,10-6+ |
| InChIKey | BIMOZPOUMMNZJX-RCFWGOLESA-N |
| XLogP | 2.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|