C22H35F2N3O — CID 135265860
2-[[(4E,5Z,8Z,10E)-4-ethylidene-9,11-difluoro-8-methyldodeca-5,8,10-trien-3-yl]amino]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 135265860) has the molecular formula C22H35F2N3O and a molecular weight of 395.54 g/mol. Its IUPAC name is 2-[[(4E,5Z,8Z,10E)-4-ethylidene-9,11-difluoro-8-methyldodeca-5,8,10-trien-3-yl]amino]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[[(4E,5Z,8Z,10E)-4-ethylidene-9,11-difluoro-8-methyldodeca-5,8,10-trien-3-yl]amino]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 135265860 |
| Molecular Formula | C22H35F2N3O |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 2-[[(4E,5Z,8Z,10E)-4-ethylidene-9,11-difluoro-8-methyldodeca-5,8,10-trien-3-yl]amino]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | C/C=C(\C=C/C/C(C)=C(F)/C=C(\C)F)C(CC)NCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H35F2N3O/c1-6-19(10-8-9-17(3)20(24)15-18(4)23)21(7-2)25-16-22(28)27-13-11-26(5)12-14-27/h6,8,10,15,21,25H,7,9,11-14,16H2,1-5H3/b10-8-,18-15+,19-6+,20-17- |
| InChIKey | KQKLQNIEFIHNLT-CLAZIGPESA-N |
| XLogP | 4.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|