C18H27N5O8 — CID 144693486
3-[[2-[[2-[[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propanoic acid (PubChem CID 144693486) has the molecular formula C18H27N5O8 and a molecular weight of 441.44 g/mol. Its IUPAC name is 3-[[2-[[2-[[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[[2-[[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 144693486 |
| Molecular Formula | C18H27N5O8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-[[2-[[2-[[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propanoic acid |
| SMILES | CN(CCCC(=O)NCC(=O)NCC(=O)NCC(=O)NCCC(=O)O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C18H27N5O8/c1-23(17(29)5-3-9-24)8-2-4-13(25)20-11-15(27)22-12-16(28)21-10-14(26)19-7-6-18(30)31/h3,5,9H,2,4,6-8,10-12H2,1H3,(H,19,26)(H,20,25)(H,21,28)(H,22,27)(H,30,31)/b5-3- |
| InChIKey | SXBKCUVUVYAZCX-HYXAFXHYSA-N |
| XLogP | -3.08 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|