C24H39N5O11 — CID 146322838
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-[methyl-[(Z)-4-oxobut-2-enoyl]amino]pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 146322838) has the molecular formula C24H39N5O11 and a molecular weight of 573.60 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-[methyl-[(Z)-4-oxobut-2-enoyl]amino]pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-[methyl-[(Z)-4-oxobut-2-enoyl]amino]pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 146322838 |
| Molecular Formula | C24H39N5O11 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-[methyl-[(Z)-4-oxobut-2-enoyl]amino]pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | CN(CCCCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C24H39N5O11/c1-26(20(32)6-5-13-30)8-4-2-3-7-25-19(31)14-28(16-22(35)36)11-9-27(15-21(33)34)10-12-29(17-23(37)38)18-24(39)40/h5-6,13H,2-4,7-12,14-18H2,1H3,(H,25,31)(H,33,34)(H,35,36)(H,37,38)(H,39,40)/b6-5- |
| InChIKey | GGOMHAOTZBROJQ-WAYWQWQTSA-N |
| XLogP | -2.27 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|