C23H43N5O10 — CID 20659060
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid (PubChem CID 20659060) has the molecular formula C23H43N5O10 and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 20659060 |
| Molecular Formula | C23H43N5O10 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid |
| SMILES | C=CC(=O)NCCCCCCNOCCN(CCOO)CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C23H43N5O10/c1-2-20(29)24-7-5-3-4-6-8-25-37-15-13-26(14-16-38-36)9-10-27(17-21(30)31)11-12-28(18-22(32)33)19-23(34)35/h2,25,36H,1,3-19H2,(H,24,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | ZAUYXUQNTKIMCI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 201.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|