C24H36N5O11- — CID 153397206
2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetate (PubChem CID 153397206) has the molecular formula C24H36N5O11- and a molecular weight of 570.58 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetate.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetate |
|---|---|
| PubChem CID | 153397206 |
| Molecular Formula | C24H36N5O11- |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)NCCCCCCN1C(=O)C=CC1=O)CC(=O)O |
| InChI | InChI=1S/C24H37N5O11/c30-18(25-7-3-1-2-4-8-29-19(31)5-6-20(29)32)13-26(9-11-27(14-21(33)34)15-22(35)36)10-12-28(16-23(37)38)17-24(39)40/h5-6H,1-4,7-17H2,(H,25,30)(H,33,34)(H,35,36)(H,37,38)(H,39,40)/p-1 |
| InChIKey | ACKSPTJKUBPKPL-UHFFFAOYSA-M |
| XLogP | -3.50 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|