C24H35N5O11-4 — CID 153397200
2-[2-[carboxylatomethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-[2-[carboxylatomethyl-(2-hydroxy-2-oxidoethyl)amino]ethyl]amino]acetate (PubChem CID 153397200) has the molecular formula C24H35N5O11-4 and a molecular weight of 569.57 g/mol. Its IUPAC name is 2-[2-[carboxylatomethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-[2-[carboxylatomethyl-(2-hydroxy-2-oxidoethyl)amino]ethyl]amino]acetate.
| Compound Name | 2-[2-[carboxylatomethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-[2-[carboxylatomethyl-(2-hydroxy-2-oxidoethyl)amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 153397200 |
| Molecular Formula | C24H35N5O11-4 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 2-[2-[carboxylatomethyl-[2-[6-(2,5-dioxopyrrol-1-yl)hexylamino]-2-oxoethyl]amino]ethyl-[2-[carboxylatomethyl-(2-hydroxy-2-oxidoethyl)amino]ethyl]amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)NCCCCCCN1C(=O)C=CC1=O)CCN(CC(=O)[O-])CC([O-])O |
| InChI | InChI=1S/C24H38N5O11/c30-18(25-7-3-1-2-4-8-29-19(31)5-6-20(29)32)13-27(15-22(35)36)11-9-26(14-21(33)34)10-12-28(16-23(37)38)17-24(39)40/h5-6,23,37H,1-4,7-17H2,(H,25,30)(H,33,34)(H,35,36)(H,39,40)/q-1/p-3 |
| InChIKey | XHCWBESCRITZPW-UHFFFAOYSA-K |
| XLogP | -7.58 |
| TPSA | 239.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | -7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|