C22H34N6O9 — CID 58113763
2-[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 58113763) has the molecular formula C22H34N6O9 and a molecular weight of 526.55 g/mol. Its IUPAC name is 2-[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 58113763 |
| Molecular Formula | C22H34N6O9 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2-[4-[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(formyloxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=COCN1CCN(COC=O)CCN(CC(=O)NCCN2C(=O)C=CC2=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H34N6O9/c29-17-36-15-26-9-7-24(13-19(31)23-3-4-28-20(32)1-2-21(28)33)5-6-25(14-22(34)35)8-10-27(12-11-26)16-37-18-30/h1-2,17-18H,3-16H2,(H,23,31)(H,34,35) |
| InChIKey | QZTZYSCCZAFZNZ-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 169.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|