C10H17N — CID 144693494
(5Z)-N-ethylocta-5,7-dien-4-imine (PubChem CID 144693494) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (5Z)-N-ethylocta-5,7-dien-4-imine.
| Compound Name | (5Z)-N-ethylocta-5,7-dien-4-imine |
|---|---|
| PubChem CID | 144693494 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (5Z)-N-ethylocta-5,7-dien-4-imine |
| SMILES | C=C/C=C\C(CCC)=N\CC |
| InChI | InChI=1S/C10H17N/c1-4-7-9-10(8-5-2)11-6-3/h4,7,9H,1,5-6,8H2,2-3H3/b9-7-,11-10+ |
| InChIKey | URGZFGLHNOKFFH-NKTIYDDZSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|