C20H23FN2O2 — CID 144693916
ethane;2-fluoro-5-[6-(3-hydroxy-3-methylbut-1-ynyl)-2-methyl-3-pyridinyl]benzamide (PubChem CID 144693916) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is ethane;2-fluoro-5-[6-(3-hydroxy-3-methylbut-1-ynyl)-2-methyl-3-pyridinyl]benzamide.
| Compound Name | ethane;2-fluoro-5-[6-(3-hydroxy-3-methylbut-1-ynyl)-2-methyl-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 144693916 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethane;2-fluoro-5-[6-(3-hydroxy-3-methylbut-1-ynyl)-2-methyl-3-pyridinyl]benzamide |
| SMILES | CC.Cc1nc(C#CC(C)(C)O)ccc1-c1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C18H17FN2O2.C2H6/c1-11-14(6-5-13(21-11)8-9-18(2,3)23)12-4-7-16(19)15(10-12)17(20)22;1-2/h4-7,10,23H,1-3H3,(H2,20,22);1-2H3 |
| InChIKey | OOQJHDPLNGFCEK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|