C25H29N6O2+ — CID 144697571
[(2-amino-5-propan-2-yloxyphenyl)-[2-[(1-pyridin-2-ylpyrrolidine-3-carbonyl)amino]-4-pyridinyl]methylidene]azanium (PubChem CID 144697571) has the molecular formula C25H29N6O2+ and a molecular weight of 445.55 g/mol. Its IUPAC name is [(2-amino-5-propan-2-yloxyphenyl)-[2-[(1-pyridin-2-ylpyrrolidine-3-carbonyl)amino]-4-pyridinyl]methylidene]azanium.
| Compound Name | [(2-amino-5-propan-2-yloxyphenyl)-[2-[(1-pyridin-2-ylpyrrolidine-3-carbonyl)amino]-4-pyridinyl]methylidene]azanium |
|---|---|
| PubChem CID | 144697571 |
| Molecular Formula | C25H29N6O2+ |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [(2-amino-5-propan-2-yloxyphenyl)-[2-[(1-pyridin-2-ylpyrrolidine-3-carbonyl)amino]-4-pyridinyl]methylidene]azanium |
| SMILES | CC(C)Oc1ccc(N)c(C(=[NH2+])c2ccnc(NC(=O)C3CCN(c4ccccn4)C3)c2)c1 |
| InChI | InChI=1S/C25H28N6O2/c1-16(2)33-19-6-7-21(26)20(14-19)24(27)17-8-11-28-22(13-17)30-25(32)18-9-12-31(15-18)23-5-3-4-10-29-23/h3-8,10-11,13-14,16,18,27H,9,12,15,26H2,1-2H3,(H,28,30,32)/p+1 |
| InChIKey | UDEZYGMCSSBMOV-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|