C22H36ClN6O8P — CID 144698051
heptan-2-yl (2S)-2-[[[(3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-chlorophosphoryl]amino]propanoate (PubChem CID 144698051) has the molecular formula C22H36ClN6O8P and a molecular weight of 578.99 g/mol. Its IUPAC name is heptan-2-yl (2S)-2-[[[(3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-chlorophosphoryl]amino]propanoate.
| Compound Name | heptan-2-yl (2S)-2-[[[(3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-chlorophosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144698051 |
| Molecular Formula | C22H36ClN6O8P |
| Molecular Weight | 578.99 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | heptan-2-yl (2S)-2-[[[(3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-chlorophosphoryl]amino]propanoate |
| SMILES | CCCCCC(C)OC(=O)[C@H](C)NP(=O)(Cl)OCC1OC(n2cnc3c(OC)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C22H36ClN6O8P/c1-6-7-8-9-12(2)36-19(31)13(3)28-38(23,33)35-10-14-16(30)22(4,32)20(37-14)29-11-25-15-17(29)26-21(24)27-18(15)34-5/h11-14,16,20,30,32H,6-10H2,1-5H3,(H,28,33)(H2,24,26,27)/t12?,13-,14?,16+,20?,22+,38?/m0/s1 |
| InChIKey | YPGCIDRGXZIWFO-NXOWWUADSA-N |
| XLogP | 2.28 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.99 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|