C20H34N7O8P — CID 66978734
2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(pentylamino)phosphoryl]amino]propanoic acid (PubChem CID 66978734) has the molecular formula C20H34N7O8P and a molecular weight of 531.51 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(pentylamino)phosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(pentylamino)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 66978734 |
| Molecular Formula | C20H34N7O8P |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(pentylamino)phosphoryl]amino]propanoic acid |
| SMILES | CCCCCNP(=O)(NC(C)C(=O)O)OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C20H34N7O8P/c1-5-6-7-8-23-36(32,26-11(2)17(29)30)34-9-12-14(28)20(3,31)18(35-12)27-10-22-13-15(27)24-19(21)25-16(13)33-4/h10-12,14,18,28,31H,5-9H2,1-4H3,(H,29,30)(H2,21,24,25)(H2,23,26,32)/t11?,12-,14-,18-,20-,36?/m1/s1 |
| InChIKey | FJZASZYBERGXGZ-BHKQKQBLSA-N |
| XLogP | 0.39 |
| TPSA | 216.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|