C17H17N3O2 — CID 144698632
N-[4-(3-aminophenyl)-5,6-dihydro-4H-1,3-oxazin-2-yl]benzamide (PubChem CID 144698632) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[4-(3-aminophenyl)-5,6-dihydro-4H-1,3-oxazin-2-yl]benzamide.
| Compound Name | N-[4-(3-aminophenyl)-5,6-dihydro-4H-1,3-oxazin-2-yl]benzamide |
|---|---|
| PubChem CID | 144698632 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[4-(3-aminophenyl)-5,6-dihydro-4H-1,3-oxazin-2-yl]benzamide |
| SMILES | Nc1cccc(C2CCOC(NC(=O)c3ccccc3)=N2)c1 |
| InChI | InChI=1S/C17H17N3O2/c18-14-8-4-7-13(11-14)15-9-10-22-17(19-15)20-16(21)12-5-2-1-3-6-12/h1-8,11,15H,9-10,18H2,(H,19,20,21) |
| InChIKey | OTLMYNZYRSSNLU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|