About (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid
(3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid (PubChem CID 158171259) has the molecular formula C19H20B2N2O5
and a molecular weight of 378.00 g/mol. Its IUPAC name is (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid.
Molecular Properties
| Compound Name | (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid |
| PubChem CID | 158171259 |
| Molecular Formula | C19H20B2N2O5 |
| Molecular Weight | 378.00 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid |
| SMILES | Nc1cccc(B(O)O)c1.O=C(Nc1cccc(B(O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C13H12BNO3.C6H8BNO2/c16-13(10-5-2-1-3-6-10)15-12-8-4-7-11(9-12)14(17)18;8-6-3-1-2-5(4-6)7(9)10/h1-9,17-18H,(H,15,16);1-4,9-10H,8H2 |
| InChIKey | FXMBQJWHGBDXCB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.00 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid?
The IUPAC name of (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid (CID 158171259) is (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid.
What is the SMILES notation for (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid?
The canonical SMILES for (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid is Nc1cccc(B(O)O)c1.O=C(Nc1cccc(B(O)O)c1)c1ccccc1.
What is the InChIKey of (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid?
The InChIKey is FXMBQJWHGBDXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BNO3.C6H8BNO2/c16-13(10-5-2-1-3-6-10)15-12-8-4-7-11(9-12)14(17)18;8-6-3-1-2-5(4-6)7(9)10/h1-9,17-18H,(H,15,16);1-4,9-10H,8H2.
What are the key properties of (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid?
(3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid has a molecular weight of 378.00 g/mol, XLogP of -0.43, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl)boronic acid;(3-benzamidophenyl)boronic acid is sourced from PubChem (CID 158171259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).