C19H17F2N3O2 — CID 90413250
N-[(1S,5R,6S)-5-(3-aminophenyl)-5-(difluoromethyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide (PubChem CID 90413250) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is N-[(1S,5R,6S)-5-(3-aminophenyl)-5-(difluoromethyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide.
| Compound Name | N-[(1S,5R,6S)-5-(3-aminophenyl)-5-(difluoromethyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide |
|---|---|
| PubChem CID | 90413250 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[(1S,5R,6S)-5-(3-aminophenyl)-5-(difluoromethyl)-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-yl]benzamide |
| SMILES | Nc1cccc([C@]2(C(F)F)N=C(NC(=O)c3ccccc3)O[C@H]3C[C@H]32)c1 |
| InChI | InChI=1S/C19H17F2N3O2/c20-17(21)19(12-7-4-8-13(22)9-12)14-10-15(14)26-18(24-19)23-16(25)11-5-2-1-3-6-11/h1-9,14-15,17H,10,22H2,(H,23,24,25)/t14-,15+,19+/m1/s1 |
| InChIKey | ZFZUQCQZCYNKRQ-VCBZYWHSSA-N |
| XLogP | 2.93 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|