C24H26FN5O2 — CID 144699751
3-cyclopropyl-4-fluoro-5-[2-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrimidin-5-yl]ethyl]benzaldehyde (PubChem CID 144699751) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-cyclopropyl-4-fluoro-5-[2-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrimidin-5-yl]ethyl]benzaldehyde.
| Compound Name | 3-cyclopropyl-4-fluoro-5-[2-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrimidin-5-yl]ethyl]benzaldehyde |
|---|---|
| PubChem CID | 144699751 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 3-cyclopropyl-4-fluoro-5-[2-[2-[[1-(oxan-4-yl)pyrazol-4-yl]amino]pyrimidin-5-yl]ethyl]benzaldehyde |
| SMILES | O=Cc1cc(CCc2cnc(Nc3cnn(C4CCOCC4)c3)nc2)c(F)c(C2CC2)c1 |
| InChI | InChI=1S/C24H26FN5O2/c25-23-19(9-17(15-31)10-22(23)18-3-4-18)2-1-16-11-26-24(27-12-16)29-20-13-28-30(14-20)21-5-7-32-8-6-21/h9-15,18,21H,1-8H2,(H,26,27,29) |
| InChIKey | HBMHYMJBOXUNJQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|