C18H17ClFN7O3 — CID 90399156
4-N-(4-chloro-3-fluorophenyl)-5-nitro-2-N-[1-(oxan-4-yl)pyrazol-4-yl]pyrimidine-2,4-diamine (PubChem CID 90399156) has the molecular formula C18H17ClFN7O3 and a molecular weight of 433.83 g/mol. Its IUPAC name is 4-N-(4-chloro-3-fluorophenyl)-5-nitro-2-N-[1-(oxan-4-yl)pyrazol-4-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-chloro-3-fluorophenyl)-5-nitro-2-N-[1-(oxan-4-yl)pyrazol-4-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90399156 |
| Molecular Formula | C18H17ClFN7O3 |
| Molecular Weight | 433.83 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-N-(4-chloro-3-fluorophenyl)-5-nitro-2-N-[1-(oxan-4-yl)pyrazol-4-yl]pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(Nc2cnn(C3CCOCC3)c2)nc1Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C18H17ClFN7O3/c19-14-2-1-11(7-15(14)20)23-17-16(27(28)29)9-21-18(25-17)24-12-8-22-26(10-12)13-3-5-30-6-4-13/h1-2,7-10,13H,3-6H2,(H2,21,23,24,25) |
| InChIKey | PNBOGYZIEVLWBE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|