C16H19BrN4O2 — CID 144700985
N-(1-aminoethylidene)-9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide;ethane (PubChem CID 144700985) has the molecular formula C16H19BrN4O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is N-(1-aminoethylidene)-9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide;ethane.
| Compound Name | N-(1-aminoethylidene)-9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144700985 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-(1-aminoethylidene)-9-bromo-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide;ethane |
| SMILES | C/C(N)=N\C(=O)c1cn2c(n1)-c1ccc(Br)cc1OCC2.CC |
| InChI | InChI=1S/C14H13BrN4O2.C2H6/c1-8(16)17-14(20)11-7-19-4-5-21-12-6-9(15)2-3-10(12)13(19)18-11;1-2/h2-3,6-7H,4-5H2,1H3,(H2,16,17,20);1-2H3 |
| InChIKey | OBVIDYGRAIHFTJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|