C15H15BrN4O2 — CID 58204902
9-bromo-N-(dimethylaminomethylidene)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide (PubChem CID 58204902) has the molecular formula C15H15BrN4O2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 9-bromo-N-(dimethylaminomethylidene)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide.
| Compound Name | 9-bromo-N-(dimethylaminomethylidene)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide |
|---|---|
| PubChem CID | 58204902 |
| Molecular Formula | C15H15BrN4O2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 9-bromo-N-(dimethylaminomethylidene)-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepine-2-carboxamide |
| SMILES | CN(C)/C=N/C(=O)c1cn2c(n1)-c1ccc(Br)cc1OCC2 |
| InChI | InChI=1S/C15H15BrN4O2/c1-19(2)9-17-15(21)12-8-20-5-6-22-13-7-10(16)3-4-11(13)14(20)18-12/h3-4,7-9H,5-6H2,1-2H3/b17-9+ |
| InChIKey | KKRWAZMGKCQWSW-RQZCQDPDSA-N |
| XLogP | 2.44 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|