C19H23NO3 — CID 144701085
tert-butyl 3-ethenyl-5-(hydroxymethyl)-2-[(Z)-prop-1-enyl]indole-1-carboxylate (PubChem CID 144701085) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl 3-ethenyl-5-(hydroxymethyl)-2-[(Z)-prop-1-enyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-ethenyl-5-(hydroxymethyl)-2-[(Z)-prop-1-enyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 144701085 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | tert-butyl 3-ethenyl-5-(hydroxymethyl)-2-[(Z)-prop-1-enyl]indole-1-carboxylate |
| SMILES | C=Cc1c(/C=C\C)n(C(=O)OC(C)(C)C)c2ccc(CO)cc12 |
| InChI | InChI=1S/C19H23NO3/c1-6-8-16-14(7-2)15-11-13(12-21)9-10-17(15)20(16)18(22)23-19(3,4)5/h6-11,21H,2,12H2,1,3-5H3/b8-6- |
| InChIKey | ZGXUPVOMXDPMJV-VURMDHGXSA-N |
| XLogP | 4.59 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |