C19H21Cl2NO6S — CID 23084091
tert-butyl 3,5-dichloro-2-(3-oxo-3-prop-2-enoxypropyl)sulfonylindole-1-carboxylate (PubChem CID 23084091) has the molecular formula C19H21Cl2NO6S and a molecular weight of 462.35 g/mol. Its IUPAC name is tert-butyl 3,5-dichloro-2-(3-oxo-3-prop-2-enoxypropyl)sulfonylindole-1-carboxylate.
| Compound Name | tert-butyl 3,5-dichloro-2-(3-oxo-3-prop-2-enoxypropyl)sulfonylindole-1-carboxylate |
|---|---|
| PubChem CID | 23084091 |
| Molecular Formula | C19H21Cl2NO6S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | tert-butyl 3,5-dichloro-2-(3-oxo-3-prop-2-enoxypropyl)sulfonylindole-1-carboxylate |
| SMILES | C=CCOC(=O)CCS(=O)(=O)c1c(Cl)c2cc(Cl)ccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H21Cl2NO6S/c1-5-9-27-15(23)8-10-29(25,26)17-16(21)13-11-12(20)6-7-14(13)22(17)18(24)28-19(2,3)4/h5-7,11H,1,8-10H2,2-4H3 |
| InChIKey | UEGYYGSGUPTZBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|