C19H22O — CID 144702282
2-methoxy-6-[(2E)-5-methylhepta-2,6-dien-3-yl]naphthalene (PubChem CID 144702282) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-methoxy-6-[(2E)-5-methylhepta-2,6-dien-3-yl]naphthalene.
| Compound Name | 2-methoxy-6-[(2E)-5-methylhepta-2,6-dien-3-yl]naphthalene |
|---|---|
| PubChem CID | 144702282 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-methoxy-6-[(2E)-5-methylhepta-2,6-dien-3-yl]naphthalene |
| SMILES | C=CC(C)C/C(=C\C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C19H22O/c1-5-14(3)11-15(6-2)16-7-8-18-13-19(20-4)10-9-17(18)12-16/h5-10,12-14H,1,11H2,2-4H3/b15-6+ |
| InChIKey | PQLBZOIPYQUKLZ-GIDUJCDVSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|