C20H23ClN2O2 — CID 144703125
[4-chloro-2-[cyano-(3,4-dimethylanilino)methyl]phenyl] formate;propane (PubChem CID 144703125) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is [4-chloro-2-[cyano-(3,4-dimethylanilino)methyl]phenyl] formate;propane.
| Compound Name | [4-chloro-2-[cyano-(3,4-dimethylanilino)methyl]phenyl] formate;propane |
|---|---|
| PubChem CID | 144703125 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [4-chloro-2-[cyano-(3,4-dimethylanilino)methyl]phenyl] formate;propane |
| SMILES | CCC.Cc1ccc(NC(C#N)c2cc(Cl)ccc2OC=O)cc1C |
| InChI | InChI=1S/C17H15ClN2O2.C3H8/c1-11-3-5-14(7-12(11)2)20-16(9-19)15-8-13(18)4-6-17(15)22-10-21;1-3-2/h3-8,10,16,20H,1-2H3;3H2,1-2H3 |
| InChIKey | WWFKFMRUARKHQF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|